missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Brucine Anhydrous 98.0+%, TCI America™
Supplier: TCI America B094625G
Specifications
| Brucine Anhydrous | |
| 179°C | |
| MFCD00005942 | |
| 1570 | |
| RRKTZKIUPZVBMF-VLTSECPOSA-N | |
| (4aR,5aS,8aR,13aS,15aR,15bS)-10,11-dimethoxy-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinoline-14-one | |
| 51413923 | |
| ≥98.0% (HPLC,T) |
| 357-57-3 | |
| C23H26N2O4 | |
| 25 g | |
| brucine, anhydrous, brucine:strychnidin-10-one,2,3-dimethoxy | |
| COC1=C(C=C2C(=C1)C34CCN5C3CC6C7C4N2C(=O)CC7OCC=C6C5)OC | |
| 394.471 | |
| 394.47 | |
| Crystalline Powder |
Chemical Identifiers
| 357-57-3 | |
| 394.471 | |
| RRKTZKIUPZVBMF-VLTSECPOSA-N | |
| 51413923 | |
| COC1=C(C=C2C(=C1)C34CCN5C3CC6C7C4N2C(=O)CC7OCC=C6C5)OC |
| C23H26N2O4 | |
| MFCD00005942 | |
| brucine, anhydrous, brucine:strychnidin-10-one,2,3-dimethoxy | |
| (4aR,5aS,8aR,13aS,15aR,15bS)-10,11-dimethoxy-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinoline-14-one |
Safety and Handling
RTECSNumber : EH8925000
TSCA : Yes