missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Calcium L-Threonate 98.0+%, TCI America™
Supplier: TCI America T179925G
Specifications
| Calcium L-Threonate | |
| White | |
| MFCD00077882,MFCD00150824 | |
| calcium l-threonate, l-threonic acid calcium salt, calcium 2r,3s-2,3,4-trihydroxybutanoate, calcium threonate, unii-hbb4ypo93u, hbb4ypo93u, calcium bis l-threonate, threonine, calcium salt, bis l-threonic acid calcium salt, butanoic acid, 2,3,4-trihydroxy-, calcium salt 2:1 , 2r,3s | |
| [Ca++].OCC(O)C(O)C([O-])=O.OCC(O)C(O)C([O-])=O | |
| 310.27 | |
| 310.27 | |
| Crystalline Powder |
| 70753-61-6 | |
| C8H14CaO10 | |
| 25 g | |
| ZJXGOFZGZFVRHK-UHFFFAOYNA-L | |
| calcium bis(2,3,4-trihydroxybutanoate) | |
| 13388558 | |
| ≥98.0% (T) |
Chemical Identifiers
| 70753-61-6 | |
| 310.27 | |
| ZJXGOFZGZFVRHK-UHFFFAOYNA-L | |
| 13388558 | |
| [Ca++].OCC(O)C(O)C([O-])=O.OCC(O)C(O)C([O-])=O |
| C8H14CaO10 | |
| MFCD00077882,MFCD00150824 | |
| calcium l-threonate, l-threonic acid calcium salt, calcium 2r,3s-2,3,4-trihydroxybutanoate, calcium threonate, unii-hbb4ypo93u, hbb4ypo93u, calcium bis l-threonate, threonine, calcium salt, bis l-threonic acid calcium salt, butanoic acid, 2,3,4-trihydroxy-, calcium salt 2:1 , 2r,3s | |
| calcium bis(2,3,4-trihydroxybutanoate) |
Safety and Handling
TSCA : No