missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Calmagite Indicator, 0.1% (w/v), Ricca Chemical
Supplier: Ricca Chemical Company 183016
Specifications
| Calmagite Indicator | |
| 98.0,0.1 | |
| 0.1% (w/v) | |
| ASFVMSDYPYMUFL-UHFFFAOYSA-N | |
| 4-[(2-hydroxy-5-methylphenyl)hydrazinylidene]-3-oxonaphthalene-1-sulfonic acid | |
| 6364506 | |
| Aqueous Solution | |
| 500 mL |
| 3147-14-6,7732-18-5 | |
| 100.0,0.1 | |
| C17H14N2O5S | |
| CC1=CC(=C(C=C1)O)NN=C2C3=CC=CC=C3C(=CC2=O)S(=O)(=O)O | |
| 358.368 | |
| Natural Poly Bottle | |
| Red | |
| Liquid |
Chemical Identifiers
| 3147-14-6 | |
| 358.368 | |
| 6364506 | |
| CC1=CC(=C(C=C1)O)NN=C2C3=CC=CC=C3C(=CC2=O)S(=O)(=O)O |
| C17H14N2O5S | |
| ASFVMSDYPYMUFL-UHFFFAOYSA-N | |
| 4-[(2-hydroxy-5-methylphenyl)hydrazinylidene]-3-oxonaphthalene-1-sulfonic acid |