missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Carbamylcholine Chloride 99.0+%, TCI America™
$218.98 - $398.16
Chemical Identifiers
| CAS | 51-83-2 |
|---|---|
| Molecular Formula | C6H15ClN2O2 |
| Molecular Weight (g/mol) | 182.65 |
| MDL Number | MFCD00012011 |
| InChI Key | AIXAANGOTKPUOY-UHFFFAOYSA-N |
| Synonym | carbachol, carbamoylcholine chloride, carbachol chloride, carbacholine, carbocholine, jestryl, doryl, carbamylcholine chloride, miostat, isopto carbachol |
| PubChem CID | 5831 |
| ChEBI | CHEBI:3385 |
| IUPAC Name | 2-(trimethylazaniumyl)ethyl carbamate chloride |
| SMILES | [Cl-].C[N+](C)(C)CCOC(N)=O |
Chemical Identifiers
| 51-83-2 | |
| 182.65 | |
| AIXAANGOTKPUOY-UHFFFAOYSA-N | |
| 5831 | |
| 2-(trimethylazaniumyl)ethyl carbamate chloride |
| C6H15ClN2O2 | |
| MFCD00012011 | |
| carbachol, carbamoylcholine chloride, carbachol chloride, carbacholine, carbocholine, jestryl, doryl, carbamylcholine chloride, miostat, isopto carbachol | |
| CHEBI:3385 | |
| [Cl-].C[N+](C)(C)CCOC(N)=O |
Specifications
| 51-83-2 | |
| White | |
| MFCD00012011 | |
| 2811 | |
| AIXAANGOTKPUOY-UHFFFAOYSA-N | |
| 2-(trimethylazaniumyl)ethyl carbamate chloride | |
| 5831 | |
| 182.65 | |
| Crystalline Powder |
| 189°C | |
| C6H15ClN2O2 | |
| 10 g | |
| carbachol, carbamoylcholine chloride, carbachol chloride, carbacholine, carbocholine, jestryl, doryl, carbamylcholine chloride, miostat, isopto carbachol | |
| [Cl-].C[N+](C)(C)CCOC(N)=O | |
| 182.65 | |
| CHEBI:3385 | |
| ≥99.0% (T) | |
| Carbamylcholine Chloride |
Safety and Handling
RTECSNumber : GA0875000
TSCA : Yes