missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Hexavalent Chromium ICP Standard, 10,000 ppm Cr6+ in 5% HCl, Ricca Chemical
Supplier: Ricca Chemical Company PCR610KH100
Specifications
| Chromium(VI) ICP Standard | |
| Natural LDPE Bottle | |
| 90.0,5.34,2.19 | |
| Orange-Yellow | |
| JOSWYUNQBRPBDN-UHFFFAOYSA-P | |
| diazanium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
| 24600 |
| 7789-09-5,7647-01-0,7732-18-5 | |
| 100 mL | |
| 94.0,5.56,2.28 | |
| Cr2H8N2O7 | |
| [NH4+].[NH4+].[O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-] | |
| 252.06 | |
| 1mL = 10mg Cr (10, 000ppm Cr)(NH4)2Cr2O7 in 5% HCl |
Chemical Identifiers
| 7789-09-5 | |
| 252.06 | |
| 24600 | |
| [NH4+].[NH4+].[O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-] |
| Cr2H8N2O7 | |
| JOSWYUNQBRPBDN-UHFFFAOYSA-P | |
| diazanium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
Safety and Handling
ShelfLife : 18 months