missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Citric Acid, 10% (w/v) from USP grade material, Ricca Chemical
Supplier: Ricca Chemical Company 21201
Specifications
| Citric Acid | |
| 89.0,9.0 | |
| 93.0,11.0 | |
| MFCD00011669 | |
| KRKNYBCHXYNGOX-UHFFFAOYSA-N | |
| 10% (w/v) | |
| 192.12 | |
| CHEBI:30769 | |
| Natural Poly Bottle |
| 77-92-9,7732-18-5 | |
| Colorless | |
| C6H8O7 | |
| citric acid, citric acid, anhydrous, citro, anhydrous citric acid, citrate, aciletten, citretten, chemfill, hydrocerol a, 1,2,3-propanetricarboxylic acid, 2-hydroxy | |
| OC(=O)CC(O)(CC(O)=O)C(O)=O | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid | |
| 311 | |
| 4 L | |
| Liquid |
Chemical Identifiers
| 77-92-9 | |
| 192.12 | |
| KRKNYBCHXYNGOX-UHFFFAOYSA-N | |
| 311 | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid |
| C6H8O7 | |
| MFCD00011669 | |
| citric acid, citric acid, anhydrous, citro, anhydrous citric acid, citrate, aciletten, citretten, chemfill, hydrocerol a, 1,2,3-propanetricarboxylic acid, 2-hydroxy | |
| CHEBI:30769 | |
| OC(=O)CC(O)(CC(O)=O)C(O)=O |