missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Citric Acid Anhydrous (Crystalline), Fisher BioReagents
Supplier: Fisher BioReagents BP339500
Description
Anhydrous citric acid is suitable for use in tissue culture systems requiring additives.Specifications
| Citric Acid Anhydrous | |
| 153°C | |
| White | |
| C6H8O7 | |
| 15, 2325 | |
| KRKNYBCHXYNGOX-UHFFFAOYSA-N | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid | |
| 311 | |
| 192.13 | |
| 500 g | |
| Poly Bottle |
| 1.7 | |
| 77-92-9 | |
| ≥99.5 % | |
| MFCD00011669 | |
| citric acid, citric acid, anhydrous, citro, anhydrous citric acid, citrate, aciletten, citretten, chemfill, hydrocerol a, 1,2,3-propanetricarboxylic acid, 2-hydroxy | |
| OC(=O)CC(O)(CC(O)=O)C(O)=O | |
| 192.12 | |
| CHEBI:30769 | |
| ≥99.5% | |
| 0.02% max. | |
| Solid |
Chemical Identifiers
| 77-92-9 | |
| 192.12 | |
| KRKNYBCHXYNGOX-UHFFFAOYSA-N | |
| 311 | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid |
| C6H8O7 | |
| MFCD00011669 | |
| citric acid, citric acid, anhydrous, citro, anhydrous citric acid, citrate, aciletten, citretten, chemfill, hydrocerol a, 1,2,3-propanetricarboxylic acid, 2-hydroxy | |
| CHEBI:30769 | |
| OC(=O)CC(O)(CC(O)=O)C(O)=O |
Safety and Handling
Recommended Storage : RT