missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Coomassie Brilliant Blue R-250, MP Biomedicals™
Supplier: MP Biomedicals Inc 0219068290
Specifications
| Coomassie Brilliant Blue R-250 | |
| 6104-59-2 | |
| C45H44N3NaO7S2 | |
| Brilliant Blue R, Acid Blue 83 | |
| [Na+].CCOC1=CC=C(NC2=CC=C(C=C2)[C+](C2=CC=C(C=C2)N(CC)CC2=CC=CC(=C2)S([O-])(=O)=O)C2=CC=C(C=C2)N(CC)CC2=CC=CC(=C2)S([O-])(=O)=O)C=C1 | |
| 825.97 | |
| 826 | |
| 500 g |
| Protein stain in electrophoresis. | |
| ∽ 50% | |
| MFCD00041762 | |
| HAEGGLCXLFWTBE-UHFFFAOYSA-M | |
| sodium {4-[(4-ethoxyphenyl)amino]phenyl}bis(4-{ethyl[(3-sulfonatophenyl)methyl]amino}phenyl)methylium | |
| 61365 | |
| Brown to Purple | |
| Powder |
Chemical Identifiers
| 6104-59-2 | |
| 825.97 | |
| HAEGGLCXLFWTBE-UHFFFAOYSA-M | |
| 61365 | |
| [Na+].CCOC1=CC=C(NC2=CC=C(C=C2)[C+](C2=CC=C(C=C2)N(CC)CC2=CC=CC(=C2)S([O-])(=O)=O)C2=CC=C(C=C2)N(CC)CC2=CC=CC(=C2)S([O-])(=O)=O)C=C1 |
| C45H44N3NaO7S2 | |
| MFCD00041762 | |
| Brilliant Blue R, Acid Blue 83 | |
| sodium {4-[(4-ethoxyphenyl)amino]phenyl}bis(4-{ethyl[(3-sulfonatophenyl)methyl]amino}phenyl)methylium |