missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Copper(II) Dimethyldithiocarbamate 98.0+%, TCI America™
Supplier: TCI America D102225G
Specifications
| Copper(II) Dimethyldithiocarbamate | |
| C6H12CuN2S4 | |
| 25 g | |
| Dimethyldithiocarbamic Acid Copper(II) Salt | |
| CN(C)C(=S)[S-].CN(C)C(=S)[S-].[Cu+2] | |
| 303.962 | |
| 303.96 | |
| Crystalline Powder |
| 137-29-1 | |
| MFCD00050845 | |
| 3077 | |
| ZOUQIAGHKFLHIA-UHFFFAOYSA-L | |
| copper;N,N-dimethylcarbamodithioate | |
| 472181 | |
| ≥98.0% (T) |
Chemical Identifiers
| 137-29-1 | |
| 303.962 | |
| ZOUQIAGHKFLHIA-UHFFFAOYSA-L | |
| 472181 | |
| CN(C)C(=S)[S-].CN(C)C(=S)[S-].[Cu+2] |
| C6H12CuN2S4 | |
| MFCD00050845 | |
| Dimethyldithiocarbamic Acid Copper(II) Salt | |
| copper;N,N-dimethylcarbamodithioate |
Safety and Handling
EINECSNumber : (2)-1833
RTECSNumber : FA0175000
TSCA : Yes