missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Thermo Scientific Chemicals Cresol Red, Indicator Grade, Pure
$42.40 - $434.06
Chemical Identifiers
| CAS | 1733-12-6 |
|---|---|
| Molecular Formula | C21H18O5S |
| Molecular Weight (g/mol) | 382.43 |
| MDL Number | MFCD00005878 |
| InChI Key | OBRMNDMBJQTZHV-UHFFFAOYSA-N |
| PubChem CID | 73013 |
| ChEBI | CHEBI:86218 |
| IUPAC Name | 4-[3-(4-hydroxy-3-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-2-methylphenol |
| SMILES | CC1=CC(=CC=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(C)=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC151380050
|
Thermo Scientific Chemicals
151380050 |
5 g | Glass bottle |
Each for $42.40
|
|
||||
|
AC151380250
|
Thermo Scientific Chemicals
151380250 |
25 g | Glass bottle |
Each for $122.47
|
|
||||
|
AC151381000
|
Thermo Scientific Chemicals
151381000 |
100 g | Glass bottle |
Each for $434.06
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorChemical Identifiers
| 1733-12-6 | |
| 382.43 | |
| OBRMNDMBJQTZHV-UHFFFAOYSA-N | |
| CHEBI:86218 | |
| CC1=CC(=CC=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(C)=C1 |
| C21H18O5S | |
| MFCD00005878 | |
| 73013 | |
| 4-[3-(4-hydroxy-3-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-2-methylphenol |
Specifications
| 290.0°C | |
| C21H18O5S | |
| 19, 91 | |
| Solubility in water: soluble. Other solubilities: soluble in dil. acids, dil. alkalies and ethanol,, insoluble in diethyl ether, benzene | |
| Authentic | |
| 4-[3-(4-hydroxy-3-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-2-methylphenol | |
| 73013 | |
| 382.42 | |
| Glass bottle | |
| from pH 7.0 (orange) to pH 8.8 (purple) | |
| 5 g | |
| Cresol Red |
| 1733-12-6 | |
| MFCD00005878 | |
| 15, 2568 | |
| OBRMNDMBJQTZHV-UHFFFAOYSA-N | |
| CC1=CC(=CC=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(C)=C1 | |
| 382.43 | |
| CHEBI:86218 | |
| Pure | |
| 1500 min. (572nm, in 0.01N NaOH) | |
| Brown/Red or Green | |
| Powder |
RUO – Research Use Only