missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
D-Phenylalanine 98.0+%, TCI America™
Supplier: TCI America P01355G
Specifications
| D-Phenylalanine | |
| White | |
| MFCD00004270 | |
| COLNVLDHVKWLRT-MRVPVSSYSA-N | |
| (2R)-2-amino-3-phenylpropanoic acid | |
| 165.19 | |
| CHEBI:16998 | |
| ≥98.0% (T) |
| 673-06-3 | |
| C9H11NO2 | |
| d-phenylalanine, h-d-phe-oh, 2r-2-amino-3-phenylpropanoic acid, d-phe, sabiden, phenylalanine d-form, alanine, phenyl-, d, d-diphenylalanine, r-2-amino-3-phenylpropanoic acid, d-alpha-amino-beta-phenylpropionic acid | |
| N[C@H](CC1=CC=CC=C1)C(O)=O | |
| 5 g | |
| 71567 | |
| 165.19 | |
| Crystalline Powder |
Chemical Identifiers
| 673-06-3 | |
| 165.19 | |
| COLNVLDHVKWLRT-MRVPVSSYSA-N | |
| 71567 | |
| (2R)-2-amino-3-phenylpropanoic acid |
| C9H11NO2 | |
| MFCD00004270 | |
| d-phenylalanine, h-d-phe-oh, 2r-2-amino-3-phenylpropanoic acid, d-phe, sabiden, phenylalanine d-form, alanine, phenyl-, d, d-diphenylalanine, r-2-amino-3-phenylpropanoic acid, d-alpha-amino-beta-phenylpropionic acid | |
| CHEBI:16998 | |
| N[C@H](CC1=CC=CC=C1)C(O)=O |
Safety and Handling
EINECSNumber : (9)-1282
RTECSNumber : AY7533000
TSCA : Yes