missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
(-)-Diethyl D-tartrate, 99%, made from unnatural tartaric acid, Thermo Scientific Chemicals
$50.61 - $50.61
Chemical Identifiers
| CAS | 13811-71-7 |
|---|---|
| Molecular Formula | C8H14O6 |
| Molecular Weight (g/mol) | 206.19 |
| MDL Number | MFCD00064451 |
| InChI Key | YSAVZVORKRDODB-WDSKDSINSA-N |
| Synonym | --diethyl d-tartrate, 2s,3s-diethyl 2,3-dihydroxysuccinate, diethyl d-tartrate, d---tartaric acid diethyl ester, diethyl d---tartrate, diethyl-d-tartrate, diethyl 2s,3s-2,3-dihydroxybutanedioate, 2s,3s--dihydroxybutane-1,4-dioic acid diethyl ester, --diethyl-d-tartrate, diethyl s-r*,r*-tartrate |
| PubChem CID | 117410 |
| IUPAC Name | diethyl (2S,3S)-2,3-dihydroxybutanedioate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)C(=O)OCC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC200340050
|
Thermo Scientific Chemicals
200340050 |
5 mL | Glass bottle |
N/A
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 13811-71-7 | |
| 206.19 | |
| YSAVZVORKRDODB-WDSKDSINSA-N | |
| 117410 | |
| CCOC(=O)[C@@H](O)[C@H](O)C(=O)OCC |
| C8H14O6 | |
| MFCD00064451 | |
| --diethyl d-tartrate, 2s,3s-diethyl 2,3-dihydroxysuccinate, diethyl d-tartrate, d---tartaric acid diethyl ester, diethyl d---tartrate, diethyl-d-tartrate, diethyl 2s,3s-2,3-dihydroxybutanedioate, 2s,3s--dihydroxybutane-1,4-dioic acid diethyl ester, --diethyl-d-tartrate, diethyl s-r*,r*-tartrate | |
| diethyl (2S,3S)-2,3-dihydroxybutanedioate |
Specifications
| 13811-71-7 | |
| 100.0 | |
| Colorless | |
| 280.0°C | |
| Authentic | |
| Glass bottle | |
| 1.4450 to 1.4470 | |
| MFCD00064451 | |
| 03, I, 181 | |
| 1.2 | |
| − 9.00 | |
| Solubility in water: insoluble. Other solubilities: soluble in organic solvents | |
| CCOC(=O)[C@@H](O)[C@H](O)C(=O)OCC | |
| 206.19 | |
| 206.19 | |
| Viscous Liquid |
| 98.5 | |
| 17.0°C | |
| 1.2000g/mL | |
| 93°C | |
| 98.5% min. (GC) | |
| C8H14O6 | |
| [-CH(OH)CO2C2H5]2 | |
| 5 mL | |
| 11,181; 13,202; 16,54 | |
| −9° (20°C neat) | |
| --diethyl d-tartrate, 2s,3s-diethyl 2,3-dihydroxysuccinate, diethyl d-tartrate, d---tartaric acid diethyl ester, diethyl d---tartrate, diethyl-d-tartrate, diethyl 2s,3s-2,3-dihydroxybutanedioate, 2s,3s--dihydroxybutane-1,4-dioic acid diethyl ester, --diethyl-d-tartrate, diethyl s-r*,r*-tartrate | |
| YSAVZVORKRDODB-WDSKDSINSA-N | |
| diethyl (2S,3S)-2,3-dihydroxybutanedioate | |
| 117410 | |
| 99% | |
| (-)-Diethyl D-tartrate, Made from unnatural tartaric acid |
Safety and Handling
EINECSNumber : 237-458-8
RUO – Research Use Only