missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Diethyl Phthalate 99.0+%, TCI America™
Supplier: TCI America P0296500ML
Specifications
| Diethyl Phthalate | |
| -41°C | |
| 296°C | |
| MFCD00009111 | |
| diethyl phthalate, phthalic acid diethyl ester, ethyl phthalate, anozol, neantine, phthalol, solvanol, diethyl o-phthalate, palatinol a, placidol e | |
| CCOC(=O)C1=CC=CC=C1C(=O)OCC | |
| 222.24 | |
| CHEBI:34698 | |
| ≥99.0% (GC) |
| 84-66-2 | |
| Colorless | |
| C12H14O4 | |
| 500 mL | |
| FLKPEMZONWLCSK-UHFFFAOYSA-N | |
| diethyl benzene-1,2-dicarboxylate | |
| 6781 | |
| 222.24 | |
| Liquid |
Chemical Identifiers
| 84-66-2 | |
| 222.24 | |
| FLKPEMZONWLCSK-UHFFFAOYSA-N | |
| 6781 | |
| diethyl benzene-1,2-dicarboxylate |
| C12H14O4 | |
| MFCD00009111 | |
| diethyl phthalate, phthalic acid diethyl ester, ethyl phthalate, anozol, neantine, phthalol, solvanol, diethyl o-phthalate, palatinol a, placidol e | |
| CHEBI:34698 | |
| CCOC(=O)C1=CC=CC=C1C(=O)OCC |
Safety and Handling
EINECSNumber : (3)-1301
RTECSNumber : TI1050000
TSCA : Yes