missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Dimethyl 5-Aminoisophthalate 98.0+%, TCI America™
Supplier: TCI America A158625G
Specifications
| Dimethyl 5-Aminoisophthalate | |
| 181°C | |
| MFCD00008435 | |
| dimethyl 5-aminoisophthalate, 3,5-dicarbomethoxyaniline, 5-aminoisophthalic acid dimethyl ester, 1,3-benzenedicarboxylic acid, 5-amino-, dimethyl ester, 1,3-dimethyl 5-aminobenzene-1,3-dicarboxylate, dimethyl5-aminoisophthalate, 5-amino-isophthalic acid dimethyl ester, 5-amino-dimethyl iso-phthalate, 5-amino-dimethylisophthalate, dimethyl-5-aminoisophthalate | |
| COC(=O)C1=CC(=CC(=C1)N)C(=O)OC | |
| 209.201 | |
| 209.20 | |
| Crystalline Powder |
| 99-27-4 | |
| C10H11NO4 | |
| 25 g | |
| DEKPYXUDJRABNK-UHFFFAOYSA-N | |
| dimethyl 5-aminobenzene-1,3-dicarboxylate | |
| 66831 | |
| ≥98.0% (HPLC,T) |
Chemical Identifiers
| 99-27-4 | |
| 209.201 | |
| DEKPYXUDJRABNK-UHFFFAOYSA-N | |
| dimethyl 5-aminobenzene-1,3-dicarboxylate |
| C10H11NO4 | |
| MFCD00008435 | |
| 66831 | |
| COC(=O)C1=CC(=CC(=C1)N)C(=O)OC |
Safety and Handling
EINECSNumber : (3)-3026
TSCA : Yes