missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Dimethyl Phthalate (Laboratory), Fisher Chemical
Supplier: Fisher Chemical D654
Specifications
Dimethyl Phthalate | |
2°C | |
1.190g/cm³ | |
Glass Bottle | |
1, 2-(CO2CH3)2C6H4 | |
4 L | |
NIQCNGHVCWTJSM-UHFFFAOYSA-N | |
1,2-dimethyl benzene-1,2-dicarboxylate | |
6.69g/mol | |
CHEBI:4609 | |
Laboratory |
131-11-3 | |
Colorless | |
282°C | |
C10H10O4 | |
MFCD00008425 | |
dimethyl phthalate, dimethylphthalate, solvanom, solvarone, avolin, fermine, phthalic acid dimethyl ester, mipax, palatinol m, unimoll dm | |
COC(=O)C1=CC=CC=C1C(=O)OC | |
194.19 | |
8554 | |
194.19 | |
Liquid |
Chemical Identifiers
131-11-3 | |
194.19 | |
NIQCNGHVCWTJSM-UHFFFAOYSA-N | |
8554 | |
1,2-dimethyl benzene-1,2-dicarboxylate |
C10H10O4 | |
MFCD00008425 | |
dimethyl phthalate, dimethylphthalate, solvanom, solvarone, avolin, fermine, phthalic acid dimethyl ester, mipax, palatinol m, unimoll dm | |
CHEBI:4609 | |
COC(=O)C1=CC=CC=C1C(=O)OC |