missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Diphenolic Acid 98.0+%, TCI America™
Supplier: TCI America D1274500G
Specifications
| Diphenolic Acid | |
| 177°C | |
| C17H18O4 | |
| 500 g | |
| VKOUCJUTMGHNOR-UHFFFAOYSA-N | |
| 4,4-bis(4-hydroxyphenyl)pentanoic acid | |
| 67174 | |
| 286.33 | |
| Crystalline Powder |
| 126-00-1 | |
| White-Yellow | |
| MFCD00002800 | |
| 4,4-Bis(4-hydroxyphenyl)valeric Acid | |
| CC(CCC(=O)O)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O | |
| 286.327 | |
| CHEBI:34721 | |
| ≥98.0% (GC,T) |
Chemical Identifiers
| 126-00-1 | |
| 286.327 | |
| VKOUCJUTMGHNOR-UHFFFAOYSA-N | |
| 67174 | |
| 4,4-bis(4-hydroxyphenyl)pentanoic acid |
| C17H18O4 | |
| MFCD00002800 | |
| 4,4-Bis(4-hydroxyphenyl)valeric Acid | |
| CHEBI:34721 | |
| CC(CCC(=O)O)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
Safety and Handling
EINECSNumber : (4)-0264
TSCA : Yes