missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Diphenylacetonitrile 99.0+%, TCI America™
$45.43 - $274.52
Chemical Identifiers
| CAS | 86-29-3 |
|---|---|
| Molecular Formula | C14H11N |
| Molecular Weight (g/mol) | 193.249 |
| MDL Number | MFCD00001862 |
| InChI Key | NEBPTMCRLHKPOB-UHFFFAOYSA-N |
| Synonym | diphenylacetonitrile, dipan, diphenatrile, benzhydrylcyanide, diphenylmethylcyanide, benzyhydrylcyanide, acetonitrile, diphenyl, benzeneacetonitrile, alpha-phenyl, usaf kf-13, difenylacetonitril |
| PubChem CID | 6837 |
| IUPAC Name | 2,2-diphenylacetonitrile |
| SMILES | C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2 |
Chemical Identifiers
| 86-29-3 | |
| 193.249 | |
| NEBPTMCRLHKPOB-UHFFFAOYSA-N | |
| 6837 | |
| C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2 |
| C14H11N | |
| MFCD00001862 | |
| diphenylacetonitrile, dipan, diphenatrile, benzhydrylcyanide, diphenylmethylcyanide, benzyhydrylcyanide, acetonitrile, diphenyl, benzeneacetonitrile, alpha-phenyl, usaf kf-13, difenylacetonitril | |
| 2,2-diphenylacetonitrile |
Specifications
| 86-29-3 | |
| White-Yellow | |
| C14H11N | |
| 25 g | |
| NEBPTMCRLHKPOB-UHFFFAOYSA-N | |
| 2,2-diphenylacetonitrile | |
| 6837 | |
| ≥99.0% (GC) | |
| Diphenylacetonitrile |
| 75°C | |
| 181°C | |
| MFCD00001862 | |
| diphenylacetonitrile, dipan, diphenatrile, benzhydrylcyanide, diphenylmethylcyanide, benzyhydrylcyanide, acetonitrile, diphenyl, benzeneacetonitrile, alpha-phenyl, usaf kf-13, difenylacetonitril | |
| C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2 | |
| 193.249 | |
| 193.25 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : (9)-0730
RTECSNumber : AL9800000
TSCA : Yes