missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diphenylacetylene, 99%
CAS: 501-65-5 | C14H10 | 178.23 g/mol
$71.24 - $164.34
Chemical Identifiers
| CAS | 501-65-5 |
|---|---|
| Molecular Formula | C14H10 |
| Molecular Weight (g/mol) | 178.23 |
| InChI Key | JRXXLCKWQFKACW-UHFFFAOYSA-N |
| Synonym | diphenylacetylene, tolan, diphenylethyne, 1,2-diphenylethyne, tolane, 1,2-diphenylacetylene, benzene, 1,1'-1,2-ethynediyl bis, biphenylacetylene, diphenyl acetylene, ethyne, diphenyl |
| PubChem CID | 10390 |
| ChEBI | CHEBI:51579 |
| IUPAC Name | 2-phenylethynylbenzene |
| SMILES | C1=CC=C(C=C1)C#CC2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC117180050
|
Thermo Scientific Chemicals
117180050 |
5 g | Glass bottle |
Each for $71.24
|
|
||||
|
AC117180250
|
Thermo Scientific Chemicals
117180250 |
25 g | Glass bottle |
Each for $164.34
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 501-65-5 | |
| 178.23 | |
| diphenylacetylene, tolan, diphenylethyne, 1,2-diphenylethyne, tolane, 1,2-diphenylacetylene, benzene, 1,1'-1,2-ethynediyl bis, biphenylacetylene, diphenyl acetylene, ethyne, diphenyl | |
| CHEBI:51579 | |
| C1=CC=C(C=C1)C#CC2=CC=CC=C2 |
| C14H10 | |
| JRXXLCKWQFKACW-UHFFFAOYSA-N | |
| 10390 | |
| 2-phenylethynylbenzene |
Specifications
| 501-65-5 | |
| Brown to Yellow | |
| 170.0°C (19.0 mmHg) | |
| 98.5% min. (GC) | |
| C14H10 | |
| 5 g | |
| 01,335 | |
| 15,9664 | |
| Solubility in water: insoluble. Other solubilities: soluble in ether and hot alcohol | |
| C1=CC=C(C=C1)C#CC2=CC=CC=C2 | |
| 178.23 | |
| CHEBI:51579 | |
| 99% | |
| Diphenylacetylene |
| 58.0°C to 61.0°C | |
| 0.9900g/mL | |
| Authentic | |
| Glass bottle | |
| C6H5C≡CC6H5 | |
| 05,656 | |
| 0.99 | |
| diphenylacetylene, tolan, diphenylethyne, 1,2-diphenylethyne, tolane, 1,2-diphenylacetylene, benzene, 1,1'-1,2-ethynediyl bis, biphenylacetylene, diphenyl acetylene, ethyne, diphenyl | |
| JRXXLCKWQFKACW-UHFFFAOYSA-N | |
| 2-phenylethynylbenzene | |
| 10390 | |
| 178.23 | |
| Crystalline Powder and/or Chunks |
Safety and Handling
EINECSNumber : 207-926-6
RUO – Research Use Only