missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Diphenylamine, 1% (w/v) in Sulfuric Acid, Ricca Chemical
$156.63 - $156.63
Chemical Identifiers
| CAS | 122-39-4 |
|---|---|
| Molecular Formula | C12H11N |
| Molecular Weight (g/mol) | 169.227 |
| InChI Key | DMBHHRLKUKUOEG-UHFFFAOYSA-N |
| Synonym | diphenylamine, n-phenylbenzenamine, anilinobenzene, benzenamine, n-phenyl, n,n-diphenylamine, phenylaniline, scaldip, n-phenylbenzeneamine, big dipper, no-scald |
| PubChem CID | 11487 |
| ChEBI | CHEBI:4640 |
| IUPAC Name | N-phenylaniline |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2 |
Chemical Identifiers
| 122-39-4 | |
| 169.227 | |
| diphenylamine, n-phenylbenzenamine, anilinobenzene, benzenamine, n-phenyl, n,n-diphenylamine, phenylaniline, scaldip, n-phenylbenzeneamine, big dipper, no-scald | |
| CHEBI:4640 | |
| C1=CC=C(C=C1)NC2=CC=CC=C2 |
| C12H11N | |
| DMBHHRLKUKUOEG-UHFFFAOYSA-N | |
| 11487 | |
| N-phenylaniline |
Specifications
| 122-39-4,7664-93-9 | |
| 100.0,0.55 | |
| Amber Glass Bottle | |
| 120 mL | |
| DMBHHRLKUKUOEG-UHFFFAOYSA-N | |
| N-phenylaniline | |
| 11487 | |
| 1% (w/v) in Sulfuric Acid | |
| Diphenylamine |
| 97.0,0.53 | |
| Colorless | |
| C12H11N | |
| diphenylamine, n-phenylbenzenamine, anilinobenzene, benzenamine, n-phenyl, n,n-diphenylamine, phenylaniline, scaldip, n-phenylbenzeneamine, big dipper, no-scald | |
| C1=CC=C(C=C1)NC2=CC=CC=C2 | |
| 169.227 | |
| CHEBI:4640 | |
| Liquid |
Safety and Handling
ShelfLife : 12 months