missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Diphenylamine Hydrochloride 99.0+%, TCI America™
Supplier: TCI America D087425G
Specifications
| Diphenylamine Hydrochloride | |
| 180°C | |
| C12H12ClN | |
| 25 g | |
| [H+].[Cl-].N(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 205.69 | |
| 205.69 | |
| Crystalline Powder |
| 537-67-7 | |
| White | |
| MFCD00042007 | |
| JEFJSEIUEJBMSR-UHFFFAOYSA-N | |
| hydrogen N-phenylaniline chloride | |
| 68311 | |
| ≥99.0% (HPLC,N) |
Chemical Identifiers
| 537-67-7 | |
| 205.69 | |
| JEFJSEIUEJBMSR-UHFFFAOYSA-N | |
| hydrogen N-phenylaniline chloride |
| C12H12ClN | |
| MFCD00042007 | |
| 68311 | |
| [H+].[Cl-].N(C1=CC=CC=C1)C1=CC=CC=C1 |
Safety and Handling
TSCA : Yes
Recommended Storage : Freezer