missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Dithizone 85.0+%, TCI America™
Supplier: TCI America D094925G
Specifications
| Dithizone | |
| 169°C | |
| MFCD00003025 | |
| dithizone, dithizon, ditizon, carbazone, diphenylthio, usaf ek-3092, diazenecarbothioic acid, phenyl-, 2-phenylhydrazide, 1,5-diphenyl-3-mercaptoformazan, 3-formazanthiol, 1,5-diphenyl, unii-njz2cj4d6p, 1,5-diphenyl-3-thiocarbazone | |
| S=C(NNC1=CC=CC=C1)N=NC1=CC=CC=C1 | |
| 256.33 | |
| 256.33 | |
| Crystalline Powder |
| 60-10-6 | |
| C13H12N4S | |
| 25 g | |
| UOFGSWVZMUXXIY-UHFFFAOYSA-N | |
| 3-(phenylamino)-1-(phenylimino)thiourea | |
| 657262 | |
| ≥85.0% (E) |
Chemical Identifiers
| 60-10-6 | |
| 256.33 | |
| UOFGSWVZMUXXIY-UHFFFAOYSA-N | |
| 657262 | |
| S=C(NNC1=CC=CC=C1)N=NC1=CC=CC=C1 |
| C13H12N4S | |
| MFCD00003025 | |
| dithizone, dithizon, ditizon, carbazone, diphenylthio, usaf ek-3092, diazenecarbothioic acid, phenyl-, 2-phenylhydrazide, 1,5-diphenyl-3-mercaptoformazan, 3-formazanthiol, 1,5-diphenyl, unii-njz2cj4d6p, 1,5-diphenyl-3-thiocarbazone | |
| 3-(phenylamino)-1-(phenylimino)thiourea |
Safety and Handling
RTECSNumber : LQ9450000
TSCA : Yes