missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
EDTA disodium salt solution, Volumetric, 0.05Â M EDTA-Na2, Honeywell Fluka™
Volumetric, 0.05Â M EDTA-Na2
Supplier: Honeywell-Fluka 318892500ML
Description
Honeywell´s high-quality titration products cover the complete titration workflow and include:
- Solutions for volumetric titration (acids, bases, or salts)
- Buffers available as concentrates or ready-to-use
- Reagents for complexometry:
- Aminopolycarboxylic acids (EDTA/NTA analogs)
- Masking agents
- Indicators for volumetric and complexometric titrations
Specifications
| Ethylenediaminetetraacetic Acid Disodium Salt Solution | |
| 500 mL | |
| [-CH2N(CH2CO2Na)CH2CO2H]2 | |
| NONH for all modes of transport | |
| ethylenediaminetetraacetic acid disodium salt, edta na2, disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid | |
| [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O | |
| 336.21 | |
| CHEBI:64734 | |
| 1.01g/mL at 25°C |
| 139-33-3 | |
| C10H14N2Na2O8 | |
| MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 | |
| 3822669 | |
| ZGTMUACCHSMWAC-UHFFFAOYSA-L | |
| disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate | |
| 57339238 | |
| 336.21g/mol |
Chemical Identifiers
| 139-33-3 | |
| 336.21 | |
| ZGTMUACCHSMWAC-UHFFFAOYSA-L | |
| 57339238 | |
| [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| C10H14N2Na2O8 | |
| MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 | |
| ethylenediaminetetraacetic acid disodium salt, edta na2, disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid | |
| CHEBI:64734 |