missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
EDTA Titrant, 0.01M solution, Macron Fine Chemicals™
macron
Supplier: Avantor H10507
Specifications
| EDTA Titrant, 0.01M solution | |
| 60-00-4 | |
| MFCD00003541 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O | |
| 292.24 | |
| CHEBI:42191 | |
| 4 L |
| Colorless | |
| C10H16N2O8 | |
| 860mg/mL | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid | |
| 6049 | |
| 292.24 | |
| Crystals |
Chemical Identifiers
| 60-00-4 | |
| 292.24 | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 6049 | |
| 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid |
| C10H16N2O8 | |
| MFCD00003541 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| CHEBI:42191 | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |