missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ethidium Bromide, Fisher BioReagents
Supplier: Fisher BioReagents BP1021
Description
- Ethidium bromide (EtBr) commonly used as a nucleic acid stain for gel electrophoresis due to its fluorescence when exposed to UV light
- Ethidium bromide intercalates double-stranded DNA and RNA
- Can be used to stain gel after electrophoresis or incorporated into the gel and running buffer
- EtBr also acts as inhibitor of RNA and DNA polymerase
Specifications
| Ethidium Bromide | |
| 260°C | |
| 4.0 to 7.0 | |
| Amber Glass | |
| MFCD00011724 | |
| 15, 4769 | |
| ZMMJGEGLRURXTF-UHFFFAOYSA-N | |
| 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;bromide | |
| 14710 | |
| 394.32 |
| 1239-45-8 | |
| Purple | |
| 5% max. | |
| C21H20BrN3 | |
| 1 g | |
| ethidium bromide, homidium bromide, dromilac, 3,8-diamino-5-ethyl-6-phenylphenanthridinium bromide, ethydium bromide, 3,8-diamino-5-ethyl-6-phenylphenanthridin-5-ium bromide, etbr, 2,7-diamino-10-ethyl-9-phenylphenanthridinium bromide, 2,7-diamino-9-phenyl-10-ethylphenanthridinium bromide, unii-059nuo2z1l | |
| [Br-].CC[N+]1=C(C2=CC=CC=C2)C2=CC(N)=CC=C2C2=CC=C(N)C=C12 | |
| 394.32 | |
| CHEBI:4883 | |
| Powder or Solid |
Chemical Identifiers
| 1239-45-8 | |
| 394.32 | |
| ZMMJGEGLRURXTF-UHFFFAOYSA-N | |
| 14710 | |
| 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;bromide |
| C21H20BrN3 | |
| MFCD00011724 | |
| ethidium bromide, homidium bromide, dromilac, 3,8-diamino-5-ethyl-6-phenylphenanthridinium bromide, ethydium bromide, 3,8-diamino-5-ethyl-6-phenylphenanthridin-5-ium bromide, etbr, 2,7-diamino-10-ethyl-9-phenylphenanthridinium bromide, 2,7-diamino-9-phenyl-10-ethylphenanthridinium bromide, unii-059nuo2z1l | |
| CHEBI:4883 | |
| [Br-].CC[N+]1=C(C2=CC=CC=C2)C2=CC(N)=CC=C2C2=CC=C(N)C=C12 |
Safety and Handling
DOTInformation : DOT Class 6.1, : Poison
TSCA : Not on TSCA inventory: for R and D use only; not for manufacturing or commercial purposes.
Recommended Storage : RT