missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ethyl 3-Bromoindole-2-carboxylate 95.0+%, TCI America™
Supplier: TCI America E09275G
Specifications
| Ethyl 3-Bromoindole-2-carboxylate | |
| 151°C | |
| C11H10BrNO2 | |
| 5 g | |
| DRJWEOYWZOGNQU-UHFFFAOYSA-N | |
| ethyl 3-bromo-1H-indole-2-carboxylate | |
| 4715017 | |
| ≥95.0% (GC) |
| 91348-45-7 | |
| Yellow | |
| MFCD02071793 | |
| ethyl 3-bromoindole-2-carboxylate, 3-bromoindole-2-carboxylic acid ethyl ester, 3-bromo-1h-indole-2-carboxylic acid ethyl ester, 3-bromo-2-indolecarboxylic acid ethyl ester, 1h-indole-2-carboxylic acid, 3-bromo-, ethyl ester, 3-br-ica-oet, ethyl 3-bromoindol-2-carboxylate, pubchem2247, pubchem7204, acmc-209r8t | |
| CCOC(=O)C1=C(Br)C2=CC=CC=C2N1 | |
| 268.11 | |
| 268.11 | |
| Crystalline Powder |
Chemical Identifiers
| 91348-45-7 | |
| 268.11 | |
| DRJWEOYWZOGNQU-UHFFFAOYSA-N | |
| 4715017 | |
| CCOC(=O)C1=C(Br)C2=CC=CC=C2N1 |
| C11H10BrNO2 | |
| MFCD02071793 | |
| ethyl 3-bromoindole-2-carboxylate, 3-bromoindole-2-carboxylic acid ethyl ester, 3-bromo-1h-indole-2-carboxylic acid ethyl ester, 3-bromo-2-indolecarboxylic acid ethyl ester, 1h-indole-2-carboxylic acid, 3-bromo-, ethyl ester, 3-br-ica-oet, ethyl 3-bromoindol-2-carboxylate, pubchem2247, pubchem7204, acmc-209r8t | |
| ethyl 3-bromo-1H-indole-2-carboxylate |
Safety and Handling
TSCA : No