missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ethyl 4-(Dimethylamino)benzoate 98.0+%, TCI America™
Supplier: TCI America D174425G
Specifications
| Ethyl 4-(Dimethylamino)benzoate | |
| 66°C | |
| C11H15NO2 | |
| 25 g | |
| FZUGPQWGEGAKET-UHFFFAOYSA-N | |
| ethyl 4-(dimethylamino)benzoate | |
| 25127 | |
| 193.25 | |
| Crystalline Powder |
| 10287-53-3 | |
| 191°C | |
| MFCD00009115 | |
| ethyl 4-dimethylamino benzoate, parbenate, benzoic acid, 4-dimethylamino-, ethyl ester, kayacure epa, ethyl-p-dimethylaminobenzoate, ethyl-4-dimethylaminobenzoate, n,n-dimethylbenzocaine, speedcure edb, ethyl p-dimethylaminobenzoate, unii-829s8d3y0x | |
| CCOC(=O)C1=CC=C(C=C1)N(C)C | |
| 193.246 | |
| CHEBI:52073 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 10287-53-3 | |
| 193.246 | |
| FZUGPQWGEGAKET-UHFFFAOYSA-N | |
| 25127 | |
| ethyl 4-(dimethylamino)benzoate |
| C11H15NO2 | |
| MFCD00009115 | |
| ethyl 4-dimethylamino benzoate, parbenate, benzoic acid, 4-dimethylamino-, ethyl ester, kayacure epa, ethyl-p-dimethylaminobenzoate, ethyl-4-dimethylaminobenzoate, n,n-dimethylbenzocaine, speedcure edb, ethyl p-dimethylaminobenzoate, unii-829s8d3y0x | |
| CHEBI:52073 | |
| CCOC(=O)C1=CC=C(C=C1)N(C)C |
Safety and Handling
EINECSNumber : (3)-3788
TSCA : Yes