missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ethyl 4-Hydroxy-3-methoxycinnamate 97.0+%, TCI America™
Supplier: TCI America E07395G
Specifications
| Ethyl 4-Hydroxy-3-methoxycinnamate | |
| 57°C | |
| 185°C | |
| MFCD00009190 | |
| ethyl ferulate, ferulic acid ethyl ester, ethyl 3-4-hydroxy-3-methoxyphenyl acrylate, unii-5b8915uelw, ethyl 4'-hydroxy-3'-methoxycinnamate, e-ethyl 3-4-hydroxy-3-methoxyphenyl acrylate, ethyl 2e-3-4-hydroxy-3-methoxyphenyl prop-2-enoate, ethyl 4-hydroxy-3-methoxycinnamate, e-3-4-hydroxy-3-methoxy-phenyl-acrylic acid ethyl ester, ethyl 4-hydroxy-3-methoxycinnamate ferulic acid ethyl ester | |
| CCOC(=O)C=CC1=CC(=C(C=C1)O)OC | |
| 222.24 | |
| 222.24 | |
| Crystalline Powder |
| 4046-02-0 | |
| Yellow | |
| C12H14O4 | |
| 5 g | |
| ATJVZXXHKSYELS-FNORWQNLSA-N | |
| ethyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate | |
| 736681 | |
| ≥97.0% (GC) |
Chemical Identifiers
| 4046-02-0 | |
| 222.24 | |
| ATJVZXXHKSYELS-FNORWQNLSA-N | |
| 736681 | |
| CCOC(=O)C=CC1=CC(=C(C=C1)O)OC |
| C12H14O4 | |
| MFCD00009190 | |
| ethyl ferulate, ferulic acid ethyl ester, ethyl 3-4-hydroxy-3-methoxyphenyl acrylate, unii-5b8915uelw, ethyl 4'-hydroxy-3'-methoxycinnamate, e-ethyl 3-4-hydroxy-3-methoxyphenyl acrylate, ethyl 2e-3-4-hydroxy-3-methoxyphenyl prop-2-enoate, ethyl 4-hydroxy-3-methoxycinnamate, e-3-4-hydroxy-3-methoxy-phenyl-acrylic acid ethyl ester, ethyl 4-hydroxy-3-methoxycinnamate ferulic acid ethyl ester | |
| ethyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
Safety and Handling
TSCA : No