missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Thermo Scientific Chemicals FerroZine(TM) iron reagent, hydrate, 98+%, pure
$109.37 - $1197.43
Chemical Identifiers
| CAS | 1266615-85-3 |
|---|---|
| Molecular Formula | C20H13N4NaO6S2 |
| Molecular Weight (g/mol) | 492.46 |
| MDL Number | MFCD00150794 |
| InChI Key | ZGVNYCXXBQPDPQ-UHFFFAOYSA-M |
| Synonym | ferrozine mono-sodium salt hydrate, ferrozine™ iron reagent, c20h13n4o6s2.na.h2o, pdt disulfonate monosodium salt hydrate, 3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p inverted exclamation marka-disulfonic acid monosodium salt hydrate, 3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p'-disulfonic acid monosodium salt hydrate |
| PubChem CID | 129893581 |
| IUPAC Name | sodium 4-[3-(pyridin-2-yl)-6-(4-sulfophenyl)-1,2,4-triazin-5-yl]benzene-1-sulfonate |
| SMILES | [Na+].OS(=O)(=O)C1=CC=C(C=C1)C1=C(N=C(N=N1)C1=CC=CC=N1)C1=CC=C(C=C1)S([O-])(=O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC410570010
|
Thermo Scientific Chemicals
410570010 |
1 g | Glass bottle |
Each for $109.37
|
|
||||
|
AC410570050
|
Thermo Scientific Chemicals
410570050 |
5 g | Glass bottle |
Each for $348.40
|
|
||||
|
AC410570250
|
Thermo Scientific Chemicals
410570250 |
25 g | Glass bottle |
Each for $1,197.43
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1266615-85-3 | |
| 492.46 | |
| ZGVNYCXXBQPDPQ-UHFFFAOYSA-M | |
| 129893581 | |
| [Na+].OS(=O)(=O)C1=CC=C(C=C1)C1=C(N=C(N=N1)C1=CC=CC=N1)C1=CC=C(C=C1)S([O-])(=O)=O |
| C20H13N4NaO6S2 | |
| MFCD00150794 | |
| ferrozine mono-sodium salt hydrate, ferrozine™ iron reagent, c20h13n4o6s2.na.h2o, pdt disulfonate monosodium salt hydrate, 3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p inverted exclamation marka-disulfonic acid monosodium salt hydrate, 3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p'-disulfonic acid monosodium salt hydrate | |
| sodium 4-[3-(pyridin-2-yl)-6-(4-sulfophenyl)-1,2,4-triazin-5-yl]benzene-1-sulfonate |
Specifications
| >300.0°C | |
| 1266615-85-3 | |
| 1 g | |
| C20H13N4NaO6S2 | |
| ferrozine mono-sodium salt hydrate, ferrozine™ iron reagent, c20h13n4o6s2.na.h2o, pdt disulfonate monosodium salt hydrate, 3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p inverted exclamation marka-disulfonic acid monosodium salt hydrate, 3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p'-disulfonic acid monosodium salt hydrate | |
| ZGVNYCXXBQPDPQ-UHFFFAOYSA-M | |
| sodium 4-[3-(pyridin-2-yl)-6-(4-sulfophenyl)-1,2,4-triazin-5-yl]benzene-1-sulfonate | |
| 129893581 | |
| ≥98% | |
| Authentic | |
| FerroZine* iron reagent,hydrate |
| Yellow | |
| Crystalline Powder | |
| 98+% | |
| MFCD00150794 | |
| Solubility in water: soluble | |
| [Na+].OS(=O)(=O)C1=CC=C(C=C1)C1=C(N=C(N=N1)C1=CC=CC=N1)C1=CC=C(C=C1)S([O-])(=O)=O | |
| 492.46 | |
| 492.46 | |
| Pure | |
| Glass bottle |
Safety and Handling
GHS Signal Word: Warning
RUO – Research Use Only