missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Specifications
| Genistein | |
| C15H10O5 | |
| 1 g | |
| TZBJGXHYKVUXJN-UHFFFAOYSA-N | |
| 5,7-dihydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one | |
| 5280961 | |
| 270.24 | |
| Crystalline Powder |
| 446-72-0 | |
| MFCD00016952 | |
| genistein, prunetol, genisteol, 4',5,7-trihydroxyisoflavone, genisterin, sophoricol, 5,7,4'-trihydroxyisoflavone, bonistein, 5,7-dihydroxy-3-4-hydroxyphenyl-4h-chromen-4-one, genestein | |
| OC1=CC=C(C=C1)C1=COC2=CC(O)=CC(O)=C2C1=O | |
| 270.24 | |
| CHEBI:28088 | |
| ≥98.0% (HPLC) |
Chemical Identifiers
| 446-72-0 | |
| 270.24 | |
| TZBJGXHYKVUXJN-UHFFFAOYSA-N | |
| 5280961 | |
| 5,7-dihydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one |
| C15H10O5 | |
| MFCD00016952 | |
| genistein, prunetol, genisteol, 4',5,7-trihydroxyisoflavone, genisterin, sophoricol, 5,7,4'-trihydroxyisoflavone, bonistein, 5,7-dihydroxy-3-4-hydroxyphenyl-4h-chromen-4-one, genestein | |
| CHEBI:28088 | |
| OC1=CC=C(C=C1)C1=COC2=CC(O)=CC(O)=C2C1=O |
Safety and Handling
RTECSNumber : NR2392000
TSCA : Yes
Recommended Storage : Refrigerator