missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Gluconic Acid (contains Gluconolactone) (45-50% in Water), TCI America™
Supplier: TCI America G003625G
Specifications
| Gluconic Acid (contains Gluconolactone) (45-50% in Water) | |
| C6H12O7 | |
| 3265 | |
| RGHNJXZEOKUKBD-SQOUGZDYSA-N | |
| (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid | |
| 10690 | |
| 196.16 | |
| Liquid |
| 526-95-4 | |
| MFCD00004240 | |
| gluconic acid, d-gluconic acid, dextronic acid, maltonic acid, glycogenic acid, glosanto, gluconate, pentahydroxycaproic acid, gluconic acid, d, d-gluconate | |
| C(C(C(C(C(C(=O)O)O)O)O)O)O | |
| 196.155 | |
| CHEBI:33198 | |
| 25 g |
Chemical Identifiers
| 526-95-4 | |
| 196.155 | |
| RGHNJXZEOKUKBD-SQOUGZDYSA-N | |
| 10690 | |
| (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
| C6H12O7 | |
| MFCD00004240 | |
| gluconic acid, d-gluconic acid, dextronic acid, maltonic acid, glycogenic acid, glosanto, gluconate, pentahydroxycaproic acid, gluconic acid, d, d-gluconate | |
| CHEBI:33198 | |
| C(C(C(C(C(C(=O)O)O)O)O)O)O |
Safety and Handling
EINECSNumber : (2)-1409
RTECSNumber : LZ5057100
TSCA : Yes