missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Thermo Scientific Chemicals HEPES sodium salt, 99+%, for molecular biology, DNAse, RNAse and Protease free
$240.47 - $735.15
Chemical Identifiers
| CAS | 75277-39-3 |
|---|---|
| Molecular Formula | C8H17N2NaO4S |
| Molecular Weight (g/mol) | 260.28 |
| MDL Number | MFCD00036463 |
| InChI Key | RDZTWEVXRGYCFV-UHFFFAOYSA-M |
| Synonym | 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid sodium salt |
| PubChem CID | 2724248 |
| ChEBI | CHEBI:46758 |
| IUPAC Name | sodium;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate |
| SMILES | [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC327261000
|
Thermo Scientific Chemicals
327261000 |
100 g | Plastic bottle |
N/A
|
|
||||
|
AC327265000
|
Thermo Scientific Chemicals
327265000 |
500 g | Plastic bottle |
N/A
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Biological bufferChemical Identifiers
| 75277-39-3 | |
| 260.28 | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| 2724248 | |
| sodium;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate |
| C8H17N2NaO4S | |
| MFCD00036463 | |
| 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid sodium salt | |
| CHEBI:46758 | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 |
Specifications
| (0.1 M in H2O), (0.1 M in H2O) at 0nm, 0.02 max. at 280nm, 0.04 max. at 260nm | |
| 248.0°C | |
| White | |
| Crystalline Powder | |
| 99+% | |
| C8H17N2NaO4S | |
| Plastic bottle | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| sodium;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate | |
| 2724248 | |
| 260.27 | |
| Molecular Biology |
| (0.1M in H2O) | |
| 75277-39-3 | |
| 5.0 to 15.0 (1% soln.) | |
| 100 g | |
| Authentic | |
| MFCD00036463 | |
| 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid sodium salt | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 | |
| 260.28 | |
| CHEBI:46758 | |
| ≥99% | |
| HEPES sodium salt, 99+% |
RUO – Research Use Only