missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ketoprofen 98.0+%, TCI America™
$320.06 - $320.06
Chemical Identifiers
| CAS | 22071-15-4 |
|---|---|
| Molecular Formula | C16H14O3 |
| Molecular Weight (g/mol) | 254.285 |
| MDL Number | MFCD00055790 |
| InChI Key | DKYWVDODHFEZIM-UHFFFAOYSA-N |
| Synonym | ketoprofen, 2-3-benzoylphenyl propanoic acid, orudis, m-benzoylhydratropic acid, 2-3-benzoylphenyl propionic acid, ketoprofene, profenid, oruvail, 3-benzoylhydratropic acid, alrheumat |
| PubChem CID | 3825 |
| ChEBI | CHEBI:6128 |
| IUPAC Name | 2-(3-benzoylphenyl)propanoic acid |
| SMILES | CC(C1=CC=CC(=C1)C(=O)C2=CC=CC=C2)C(=O)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
K003825G
|
TCI America
K003825G |
25 g |
Each for $320.06
|
|
|||||
Chemical Identifiers
| 22071-15-4 | |
| 254.285 | |
| DKYWVDODHFEZIM-UHFFFAOYSA-N | |
| 3825 | |
| 2-(3-benzoylphenyl)propanoic acid |
| C16H14O3 | |
| MFCD00055790 | |
| ketoprofen, 2-3-benzoylphenyl propanoic acid, orudis, m-benzoylhydratropic acid, 2-3-benzoylphenyl propionic acid, ketoprofene, profenid, oruvail, 3-benzoylhydratropic acid, alrheumat | |
| CHEBI:6128 | |
| CC(C1=CC=CC(=C1)C(=O)C2=CC=CC=C2)C(=O)O |
Specifications
| 22071-15-4 | |
| White | |
| MFCD00055790 | |
| 2811 | |
| DKYWVDODHFEZIM-UHFFFAOYSA-N | |
| 2-(3-benzoylphenyl)propanoic acid | |
| 3825 | |
| 254.29 | |
| Crystalline Powder |
| 95°C | |
| C16H14O3 | |
| 25 g | |
| ketoprofen, 2-3-benzoylphenyl propanoic acid, orudis, m-benzoylhydratropic acid, 2-3-benzoylphenyl propionic acid, ketoprofene, profenid, oruvail, 3-benzoylhydratropic acid, alrheumat | |
| CC(C1=CC=CC(=C1)C(=O)C2=CC=CC=C2)C(=O)O | |
| 254.285 | |
| CHEBI:6128 | |
| ≥98.0% (HPLC,T) | |
| Ketoprofen |
Safety and Handling
RTECSNumber : UE7570000
TSCA : Yes