missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
L-Ascorbic Acid (White Crystalline Powder), Fisher BioReagents
Supplier: Fisher BioReagents FLBP351500
Description
Ascorbic Acid is suitable for use in tissue culture systems requiring additives.Specifications
| Ascorbic Acid | |
| 50-81-7 | |
| Yellow | |
| 0.1% max. | |
| Glass Bottle | |
| MFCD00064328 | |
| 15, 819 | |
| l-ascorbic acid, ascorbic acid, vitamin c, l-ascorbate, ascorbate, ascorbicap, l +-ascorbic acid, cevitamic acid, ascoltin, hybrin | |
| OC[C@H](O)[C@H]1OC(=O)C(O)=C1O | |
| 176.12 | |
| CHEBI:29073 | |
| ≥99.0% |
| L-Ascorbic Acid | |
| 190°C | |
| 1.65g/cm³ | |
| ≥99.0 % | |
| C6H8O6 | |
| 500 g | |
| 20.5 to 21.5° (+ or -) | |
| CIWBSHSKHKDKBQ-DOMZIZNONA-N | |
| (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one | |
| 54670067 | |
| 176.13 | |
| Solid |
Chemical Identifiers
| 50-81-7 | |
| 176.12 | |
| CIWBSHSKHKDKBQ-DOMZIZNONA-N | |
| 54670067 | |
| (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| C6H8O6 | |
| MFCD00064328 | |
| l-ascorbic acid, ascorbic acid, vitamin c, l-ascorbate, ascorbate, ascorbicap, l +-ascorbic acid, cevitamic acid, ascoltin, hybrin | |
| CHEBI:29073 | |
| OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
Safety and Handling
Recommended Storage : RT