missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Thermo Scientific Chemicals L-Aspartyl-L-phenylalanine methyl ester, 98%
$104.15 - $1031.65
Chemical Identifiers
| CAS | 22839-47-0 |
|---|---|
| Molecular Formula | C14H18N2O5 |
| Molecular Weight (g/mol) | 294.31 |
| MDL Number | MFCD00002724 |
| InChI Key | IAOZJIPTCAWIRG-QWRGUYRKSA-N |
| Synonym | aspartame, nutrasweet, asp-phe-ome, asp-phe methyl ester, aspartam, aspartamum, aspartamo, l-aspartyl-l-phenylalanine methyl ester, aspartylphenylalanine methyl ester, dipeptide sweetener |
| PubChem CID | 134601 |
| ChEBI | CHEBI:2877 |
| IUPAC Name | (3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CC(O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC228650010
|
Thermo Scientific Chemicals
228650010 |
1 g | Glass Bottle |
Each for $104.15
|
|
||||
|
AC228650250
|
Thermo Scientific Chemicals
228650250 |
25 g | Glass Bottle |
Each for $1,031.65
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 22839-47-0 | |
| 294.31 | |
| IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
| 134601 | |
| (3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| C14H18N2O5 | |
| MFCD00002724 | |
| aspartame, nutrasweet, asp-phe-ome, asp-phe methyl ester, aspartam, aspartamum, aspartamo, l-aspartyl-l-phenylalanine methyl ester, aspartylphenylalanine methyl ester, dipeptide sweetener | |
| CHEBI:2877 | |
| COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CC(O)=O |
Specifications
| 248.0°C to 250.0°C | |
| White | |
| C14H18N2O5 | |
| HO2CCH2CH(NH2)CONHCH(CH2C6H5)CO2CH3 | |
| 4.5% max. (105°C, 4 hrs) | |
| Glass Bottle | |
| Solubility in water: sparingly soluble. | |
| COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CC(O)=O | |
| + 12.50 | |
| 134601 | |
| 95% min. (c=1, 2N HCl, 430nm) 1cm cell | |
| 98% | |
| Crystalline Powder |
| 22839-47-0 | |
| 98% | |
| Authentic | |
| MFCD00002724 | |
| 15, 829 | |
| aspartame, nutrasweet, asp-phe-ome, asp-phe methyl ester, aspartam, aspartamum, aspartamo, l-aspartyl-l-phenylalanine methyl ester, aspartylphenylalanine methyl ester, dipeptide sweetener | |
| IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
| (3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid | |
| 294.31 | |
| CHEBI:2877 | |
| 294.3 | |
| 1 g | |
| L-Aspartyl-L-phenylalanine methyl ester |
Safety and Handling
EINECSNumber : 245-261-3
RUO – Research Use Only