missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
L(+)-Gulonic acid γ-lactone, 95+%, Thermo Scientific Chemicals
$331.71 - $1175.61
Chemical Identifiers
| CAS | 1128-23-0 |
|---|---|
| Molecular Formula | C6H10O6 |
| Molecular Weight (g/mol) | 178.14 |
| InChI Key | SXZYCXMUPBBULW-SKNVOMKLSA-N |
| Synonym | l-gulonolactone, l-gulono-1,4-lactone, l-gulonic acid gamma-lactone, 3s,4r,5r-5-s-1,2-dihydroxyethyl-3,4-dihydroxydihydrofuran-2 3h-one, l-gulono-gamma-lactone, gamma-gulonolactone, l-gulonic gamma-lactone, l-+-gulono-1,4-lactone, l +-gulonic acid gamma-lactone, l-+-gulonic acid gamma-lactone |
| PubChem CID | 439373 |
| ChEBI | CHEBI:17587 |
| IUPAC Name | (3S,4R,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one |
| SMILES | C(C(C1C(C(C(=O)O1)O)O)O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC255570250
|
Thermo Scientific Chemicals
255570250 |
25 g | Glass bottle |
Each for $331.71
|
|
||||
|
AC255571000
|
Thermo Scientific Chemicals
255571000 |
100 g | Glass Bottle |
Each for $1,175.61
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1128-23-0 | |
| 178.14 | |
| l-gulonolactone, l-gulono-1,4-lactone, l-gulonic acid gamma-lactone, 3s,4r,5r-5-s-1,2-dihydroxyethyl-3,4-dihydroxydihydrofuran-2 3h-one, l-gulono-gamma-lactone, gamma-gulonolactone, l-gulonic gamma-lactone, l-+-gulono-1,4-lactone, l +-gulonic acid gamma-lactone, l-+-gulonic acid gamma-lactone | |
| CHEBI:17587 | |
| C(C(C1C(C(C(=O)O1)O)O)O)O |
| C6H10O6 | |
| SXZYCXMUPBBULW-SKNVOMKLSA-N | |
| 439373 | |
| (3S,4R,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one |
Specifications
| 1128-23-0 | |
| 0.5% max. (1 g, 105°C, 3 hrs) | |
| 95% min. (ELSD) (HPLC) | |
| C6H10O6 | |
| + 54.50 (57.50°C c=2,water) | |
| l-gulonolactone, l-gulono-1,4-lactone, l-gulonic acid gamma-lactone, 3s,4r,5r-5-s-1,2-dihydroxyethyl-3,4-dihydroxydihydrofuran-2 3h-one, l-gulono-gamma-lactone, gamma-gulonolactone, l-gulonic gamma-lactone, l-+-gulono-1,4-lactone, l +-gulonic acid gamma-lactone, l-+-gulonic acid gamma-lactone | |
| C(C(C1C(C(C(=O)O1)O)O)O)O | |
| 178.14 | |
| CHEBI:17587 | |
| 95+% | |
| L(+)-Gulonic acid γ-lactone |
| 183.0°C to 185.0°C | |
| Authentic | |
| Glass bottle | |
| 25 g | |
| + 54.50 | |
| SXZYCXMUPBBULW-SKNVOMKLSA-N | |
| (3S,4R,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one | |
| 439373 | |
| 178.14 | |
| Viscous Solution |
RUO – Research Use Only