missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Phenylalanine methyl ester hydrochloride, 98%
CAS: 7524-50-7 | C10H14ClNO2 | 215.68 g/mol
$83.56 - $83.56
Chemical Identifiers
| CAS | 7524-50-7 |
|---|---|
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight (g/mol) | 215.68 |
| MDL Number | MFCD00012489 |
| InChI Key | SWVMLNPDTIFDDY-UHFFFAOYNA-N |
| Synonym | l-phenylalanine methyl ester hydrochloride, h-phe-ome.hcl, methyl l-phenylalaninate hydrochloride, s-methyl 2-amino-3-phenylpropanoate hydrochloride, unii-47hk4y94ja, h-phe-ome hcl, h-phe-ome hydrochloride, l-phenylalanine, methyl ester, hydrochloride, l-phenylalanine methyl ester hcl |
| PubChem CID | 75736 |
| SMILES | [H+].[Cl-].COC(=O)C(N)CC1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC130320100
|
Thermo Scientific Chemicals
130320100 |
10 g | Glass bottle |
N/A
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 7524-50-7 | |
| 215.68 | |
| SWVMLNPDTIFDDY-UHFFFAOYNA-N | |
| 75736 |
| C10H14ClNO2 | |
| MFCD00012489 | |
| l-phenylalanine methyl ester hydrochloride, h-phe-ome.hcl, methyl l-phenylalaninate hydrochloride, s-methyl 2-amino-3-phenylpropanoate hydrochloride, unii-47hk4y94ja, h-phe-ome hcl, h-phe-ome hydrochloride, l-phenylalanine, methyl ester, hydrochloride, l-phenylalanine methyl ester hcl | |
| [H+].[Cl-].COC(=O)C(N)CC1=CC=CC=C1 |
Specifications
| 7524-50-7 | |
| White | |
| 97.5% min. (Argentometry) | |
| C10H14ClNO2 | |
| MFCD00012489 | |
| 14,499 | |
| + 37.00 | |
| SWVMLNPDTIFDDY-UHFFFAOYNA-N | |
| methyl (2S)-2-amino-3-phenylpropanoate;hydrochloride | |
| 75736 | |
| 98% | |
| L-Phenylalanine methyl ester hydrochloride, 98% |
| 156.0°C to 160.0°C | |
| Authentic | |
| Glass bottle | |
| C6H5CH2CH(NH2)CO2CH3·HCl | |
| 10 g | |
| + 37.00 (20.00°C c=2,C2H5OH) | |
| l-phenylalanine methyl ester hydrochloride, h-phe-ome.hcl, methyl l-phenylalaninate hydrochloride, s-methyl 2-amino-3-phenylpropanoate hydrochloride, unii-47hk4y94ja, h-phe-ome hcl, h-phe-ome hydrochloride, l-phenylalanine, methyl ester, hydrochloride, l-phenylalanine methyl ester hcl | |
| [H+].[Cl-].COC(=O)C(N)CC1=CC=CC=C1 | |
| 215.68 | |
| 215.68 | |
| Fine Crystalline Powder |
Safety and Handling
EINECSNumber : 231-383-4
RUO – Research Use Only