missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
MilliporeSigma™ L-Tyrosine, Free Base, Calbiochem™,
Supplier: MilliporeSigma™ 6570100GM
Specifications
| 60-18-4 | |
| C9H11NO3 | |
| Glass Bottle | |
| OUYCCCASQSFEME-SVGMAFHSNA-N | |
| (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid | |
| 6057 | |
| ≥98% (Titration) | |
| Solid |
| White | |
| MFCD00002606 | |
| l-tyrosine, tyrosine, s-tyrosine, p-tyrosine, h-tyr-oh, l-p-tyrosine, 2s-2-amino-3-4-hydroxyphenyl propanoic acid, 4-hydroxy-l-phenylalanine, l---tyrosine, tyrosine, l | |
| N[C@@H](CC1=CC=C(O)C=C1)C(O)=O | |
| 181.19 | |
| CHEBI:17895 | |
| 100 g |
Chemical Identifiers
| 60-18-4 | |
| 181.19 | |
| OUYCCCASQSFEME-SVGMAFHSNA-N | |
| 6057 | |
| (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid |
| C9H11NO3 | |
| MFCD00002606 | |
| l-tyrosine, tyrosine, s-tyrosine, p-tyrosine, h-tyr-oh, l-p-tyrosine, 2s-2-amino-3-4-hydroxyphenyl propanoic acid, 4-hydroxy-l-phenylalanine, l---tyrosine, tyrosine, l | |
| CHEBI:17895 | |
| N[C@@H](CC1=CC=C(O)C=C1)C(O)=O |