missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Lactose Standard 5%, Apura™ MilliporeSigma™
Supplier: Technidata 1129390010
Specifications
| 10 g | |
| Solid water standard | |
| Plastic bottle | |
| 5% | |
| Milk sugar, Lactobiose | |
| C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O.O | |
| 360.312 | |
| 360.32 (molar mass) |
| Lactose Standard | |
| 10039-26-6 | |
| Solid | |
| C12H24O12 | |
| WSVLPVUVIUVCRA-KPKNDVKVSA-N | |
| (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol;hydrate | |
| 104938 |
Chemical Identifiers
| 10039-26-6 | |
| 360.312 | |
| Milk sugar, Lactobiose | |
| (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol;hydrate |
| C12H24O12 | |
| WSVLPVUVIUVCRA-KPKNDVKVSA-N | |
| 104938 | |
| C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O.O |