missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Lawesson's Reagent, 99%
CAS: 19172-47-5 | C14H14O2P2S4 | 404.452 g/mol
$86.01 - $259.04
Chemical Identifiers
| CAS | 19172-47-5 |
|---|---|
| Molecular Formula | C14H14O2P2S4 |
| Molecular Weight (g/mol) | 404.452 |
| InChI Key | CFHGBZLNZZVTAY-UHFFFAOYSA-N |
| Synonym | lawesson's reagent, lawesson reagent, 2,4-bis 4-methoxyphenyl-1,3,2,4-dithiadiphosphetane 2,4-disulfide, unii-a4125mq8rx, 1,3,2,4-dithiadiphosphetane, 2,4-bis 4-methoxyphenyl-, 2,4-disulfide, 2,4-bis 4-methoxyphenyl-2,4-dithioxo-1,3,2,4-dithiadiphosphetane, 2,4-bis 4-methoxyphenyl-1,3,2,4-dithiadiphosphetane-2,4-disulfide, 2,4-bis 4-methoxyphenyl-1,3-dithia-2,4-diphosphetane 2,4-disulfide, 2,4-bis 4-methoxyphenyl-1,3-dithia-2,4-diphosphetane 2,4-disulphide, 4-methoxyphenylthiophosphoric cyclic di thioanhydride |
| PubChem CID | 87949 |
| IUPAC Name | 2,4-bis(4-methoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2$l^{5},4$l^{5}-dithiadiphosphetane |
| SMILES | COC1=CC=C(C=C1)P2(=S)SP(=S)(S2)C3=CC=C(C=C3)OC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC210890250
|
Thermo Scientific Chemicals
210890250 |
25 g | Glass bottle |
Each for $86.01
|
|
||||
|
AC210891000
|
Thermo Scientific Chemicals
210891000 |
100 g | Glass bottle |
Each for $259.04
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
For C-S bond formationChemical Identifiers
| 19172-47-5 | |
| 404.452 | |
| lawesson's reagent, lawesson reagent, 2,4-bis 4-methoxyphenyl-1,3,2,4-dithiadiphosphetane 2,4-disulfide, unii-a4125mq8rx, 1,3,2,4-dithiadiphosphetane, 2,4-bis 4-methoxyphenyl-, 2,4-disulfide, 2,4-bis 4-methoxyphenyl-2,4-dithioxo-1,3,2,4-dithiadiphosphetane, 2,4-bis 4-methoxyphenyl-1,3,2,4-dithiadiphosphetane-2,4-disulfide, 2,4-bis 4-methoxyphenyl-1,3-dithia-2,4-diphosphetane 2,4-disulfide, 2,4-bis 4-methoxyphenyl-1,3-dithia-2,4-diphosphetane 2,4-disulphide, 4-methoxyphenylthiophosphoric cyclic di thioanhydride | |
| 2,4-bis(4-methoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2$l^{5},4$l^{5}-dithiadiphosphetane |
| C14H14O2P2S4 | |
| CFHGBZLNZZVTAY-UHFFFAOYSA-N | |
| 87949 | |
| COC1=CC=C(C=C1)P2(=S)SP(=S)(S2)C3=CC=C(C=C3)OC |
Specifications
| White | |
| 228.0°C to 231.0°C | |
| C14H14O2P2S4 | |
| lawesson's reagent, lawesson reagent, 2,4-bis 4-methoxyphenyl-1,3,2,4-dithiadiphosphetane 2,4-disulfide, unii-a4125mq8rx, 1,3,2,4-dithiadiphosphetane, 2,4-bis 4-methoxyphenyl-, 2,4-disulfide, 2,4-bis 4-methoxyphenyl-2,4-dithioxo-1,3,2,4-dithiadiphosphetane, 2,4-bis 4-methoxyphenyl-1,3,2,4-dithiadiphosphetane-2,4-disulfide, 2,4-bis 4-methoxyphenyl-1,3-dithia-2,4-diphosphetane 2,4-disulfide, 2,4-bis 4-methoxyphenyl-1,3-dithia-2,4-diphosphetane 2,4-disulphide, 4-methoxyphenylthiophosphoric cyclic di thioanhydride | |
| CFHGBZLNZZVTAY-UHFFFAOYSA-N | |
| 2,4-bis(4-methoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2$l^{5},4$l^{5}-dithiadiphosphetane | |
| 87949 | |
| 99% | |
| 25 g | |
| Lawesson's Reagent |
| 19172-47-5 | |
| 99% | |
| 10,39; 12,59; 13,38; 15,37; 16,37 | |
| Solubility in water: decomposes. | |
| COC1=CC=C(C=C1)P2(=S)SP(=S)(S2)C3=CC=C(C=C3)OC | |
| 404.452 | |
| 404.45 | |
| Glass bottle | |
| Powder |
RUO – Research Use Only