missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Lithium Bis(fluorosulfonyl)imide 98.0+%, TCI America™
Supplier: TCI America L02815G
Specifications
| Lithium Bis(fluorosulfonyl)imide | |
| 133°C | |
| F2LiNO4S2 | |
| 5 g | |
| LiFSI | |
| [Li+].FS(=O)(=O)[N-]S(F)(=O)=O | |
| 187.06 | |
| 187.06 | |
| Crystalline Powder |
| 171611-11-3 | |
| White-Yellow | |
| MFCD28126786 | |
| 1759 | |
| VDVLPSWVDYJFRW-UHFFFAOYSA-N | |
| lithium(1+) bis(fluorosulfonyl)azanide | |
| 86277430 | |
| ≥98.0% (T) |
Chemical Identifiers
| 171611-11-3 | |
| 187.06 | |
| VDVLPSWVDYJFRW-UHFFFAOYSA-N | |
| 86277430 | |
| [Li+].FS(=O)(=O)[N-]S(F)(=O)=O |
| F2LiNO4S2 | |
| MFCD28126786 | |
| LiFSI | |
| lithium(1+) bis(fluorosulfonyl)azanide |
Safety and Handling
EINECSNumber : (1)-1247
TSCA : Yes