missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methyl 4-(Chloroformyl)benzoate 95.0+%, TCI America™
Supplier: TCI America T0283500G
Specifications
| Methyl 4-(Chloroformyl)benzoate | |
| 54°C | |
| C9H7ClO3 | |
| 500 g | |
| methyl 4-chlorocarbonyl benzoate, methyl 4-chlorocarbonylbenzoate, methyl 4-chloroformyl benzoate, terephthalic acid monomethyl ester chloride, methyl 4-carbonochloridoyl benzoate, methyl terephthaloyl chloride, benzoic acid, 4-chlorocarbonyl-, methyl ester, 4-chlorocarbonyl-benzoic acid methyl ester, 4-carbomethoxybenzoylchloride, 4-chlorocarbonylbenzoic acid methyl ester | |
| COC(=O)C1=CC=C(C=C1)C(=O)Cl | |
| 198.602 | |
| 198.60 | |
| Crystalline Powder |
| 7377-26-6 | |
| 140°C | |
| MFCD00059486 | |
| 3261 | |
| CVXXHXPNTZBZEL-UHFFFAOYSA-N | |
| methyl 4-carbonochloridoylbenzoate | |
| 81850 | |
| ≥95.0% (GC) |
Chemical Identifiers
| 7377-26-6 | |
| 198.602 | |
| CVXXHXPNTZBZEL-UHFFFAOYSA-N | |
| 81850 | |
| COC(=O)C1=CC=C(C=C1)C(=O)Cl |
| C9H7ClO3 | |
| MFCD00059486 | |
| methyl 4-chlorocarbonyl benzoate, methyl 4-chlorocarbonylbenzoate, methyl 4-chloroformyl benzoate, terephthalic acid monomethyl ester chloride, methyl 4-carbonochloridoyl benzoate, methyl terephthaloyl chloride, benzoic acid, 4-chlorocarbonyl-, methyl ester, 4-chlorocarbonyl-benzoic acid methyl ester, 4-carbomethoxybenzoylchloride, 4-chlorocarbonylbenzoic acid methyl ester | |
| methyl 4-carbonochloridoylbenzoate |
Safety and Handling
EINECSNumber : (3)-3502
TSCA : No