missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Methyl 4-Hydroxy-3,5-dimethoxybenzoate 98.0+%, TCI America™
Supplier: TCI America M28065G
Specifications
| Methyl 4-Hydroxy-3,5-dimethoxybenzoate | |
| 108°C | |
| C10H12O5 | |
| 5 g | |
| ZMXJAEGJWHJMGX-UHFFFAOYSA-N | |
| methyl 4-hydroxy-3,5-dimethoxybenzoate | |
| 70164 | |
| 212.2 | |
| Crystalline Powder |
| 884-35-5 | |
| White to Yellow | |
| MFCD00017199 | |
| methyl syringate, methyl 3,5-dimethoxy-4-hydroxybenzoate, benzoic acid, 4-hydroxy-3,5-dimethoxy-, methyl ester, syringic acid methyl ester, methyl 4-hydroxy-3,5-dimethoxy-benzoate, acmc-1bjig, ksc496o5n, syringic acid monomethyl ester, rarechem al bf 0102, timtec-bb sbb016976 | |
| COC1=CC(=CC(=C1O)OC)C(=O)OC | |
| 212.201 | |
| CHEBI:45820 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 884-35-5 | |
| 212.201 | |
| ZMXJAEGJWHJMGX-UHFFFAOYSA-N | |
| 70164 | |
| methyl 4-hydroxy-3,5-dimethoxybenzoate |
| C10H12O5 | |
| MFCD00017199 | |
| methyl syringate, methyl 3,5-dimethoxy-4-hydroxybenzoate, benzoic acid, 4-hydroxy-3,5-dimethoxy-, methyl ester, syringic acid methyl ester, methyl 4-hydroxy-3,5-dimethoxy-benzoate, acmc-1bjig, ksc496o5n, syringic acid monomethyl ester, rarechem al bf 0102, timtec-bb sbb016976 | |
| CHEBI:45820 | |
| COC1=CC(=CC(=C1O)OC)C(=O)OC |
Safety and Handling
EINECSNumber : (3)-4633
TSCA : No