missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Methyl Red Indicator, 0.1% (w/v) Alcoholic Solution, Ricca Chemical
Supplier: Ricca Chemical Company RSOD5200120C
Specifications
| 845-10-3 | |
| C15H14N3NaO2 | |
| GNTPCYMJCJNRQB-UHFFFAOYSA-M | |
| sodium;2-[[4-(dimethylamino)phenyl]diazenyl]benzoate | |
| 4465632 | |
| Characteristic alcohol | |
| Red | |
| Solution |
| 0.1% (w/v) | |
| Solubility in Water: Infinite | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=CC=C2C(=O)[O-].[Na+] | |
| 291.286 | |
| 0.10% | |
| Amber Glass Bottle | |
| 120 mL |
Chemical Identifiers
| 845-10-3 | |
| 291.286 | |
| 4465632 | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=CC=C2C(=O)[O-].[Na+] |
| C15H14N3NaO2 | |
| GNTPCYMJCJNRQB-UHFFFAOYSA-M | |
| sodium;2-[[4-(dimethylamino)phenyl]diazenyl]benzoate |
Safety and Handling
Recommended Storage : Flammable