missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
![Methylene Blue Solution (Methanol Solution) [for Cell Staining], TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/Chemical-Structures/chemical-structure-cas-61-73-4.jpg-650.jpg)
![Methylene Blue Solution (Methanol Solution) [for Cell Staining], TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/TCI-America/logos/Rings Blue.jpg-650.jpg)
Methylene Blue Solution (Methanol Solution) [for Cell Staining], TCI America™
Supplier: TCI America M2392100ML
Specifications
| Methylene Blue Solution (Methanol Solution) [for Cell Staining] | |
| Black-Blue | |
| MFCD00012111 | |
| 1230 | |
| CXKWCBBOMKCUKX-UHFFFAOYSA-M | |
| [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride | |
| 6099 | |
| 319.85 |
| 61-73-4 | |
| C16H18ClN3S | |
| 100 mL | |
| methylene blue, methylthioninium chloride, basic blue 9, swiss blue, chromosmon, methylene blue n, methylenium ceruleum, urolene blue, bleu de methylene, methylene blue chloride | |
| CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.[Cl-] | |
| 319.851 | |
| CHEBI:6872 | |
| Liquid |
Chemical Identifiers
| 61-73-4 | |
| 319.851 | |
| CXKWCBBOMKCUKX-UHFFFAOYSA-M | |
| 6099 | |
| [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride |
| C16H18ClN3S | |
| MFCD00012111 | |
| methylene blue, methylthioninium chloride, basic blue 9, swiss blue, chromosmon, methylene blue n, methylenium ceruleum, urolene blue, bleu de methylene, methylene blue chloride | |
| CHEBI:6872 | |
| CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.[Cl-] |
Safety and Handling
EINECSNumber : (5)-1995
RTECSNumber : SO5600000
TSCA : Yes