Learn More
Thermo Scientific Chemicals MOPS, 99%, for biochemistry
CAS: 1132-61-2 | C7H15NO4S | 209.26 g/mol
Supplier: Thermo Scientific Chemicals 172631000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Biological bufferSpecifications
| (1 M aq. soln.) (1 cm cell) | |
| 99% | |
| 1132-61-2 | |
| 100.0 | |
| >277°C | |
| Crystalline Powder | |
| 99% | |
| C7H15NO4S | |
| Plastic bottle | |
| 3-(N-Morpholino)propanesulfonic acid | |
| [O-]S(=O)(=O)CCC[NH+]1CCOCC1 | |
| 209.26 | |
| CHEBI:44115 | |
| ≥98.5% |
| MOPS | |
| (1M aq. soln.) (1 cm cell) | |
| 98.5 | |
| White | |
| 3.0 to 4.5 (1% aq. soln. at 25°C) | |
| 100 g | |
| Authentic | |
| MFCD00006183 | |
| 15, 6352 | |
| DVLFYONBTKHTER-UHFFFAOYSA-N | |
| 4-(3-sulfonatopropyl)morpholin-4-ium | |
| 70807 | |
| 209.26 | |
| Biochemical |
Chemical Identifiers
| 1132-61-2 | |
| 209.26 | |
| DVLFYONBTKHTER-UHFFFAOYSA-N | |
| 70807 | |
| [O-]S(=O)(=O)CCC[NH+]1CCOCC1 |
| C7H15NO4S | |
| MFCD00006183 | |
| 3-(N-Morpholino)propanesulfonic acid | |
| CHEBI:44115 |
Safety and Handling
GHS H Statement:
Causes skin irritation.
May cause respiratory irritation.
Causes serious eye irritation.
Emergency Overview
Causes eye, skin, and respiratory tract irritation.
NFPA
Health: 2
Flammability:
Warning
EINECSNumber : 214-478-5
RTECSNumber : QE9104530
TSCA : TSCA
RUO – Research Use Only