missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
N-(m-Toluoyl)glycine 98.0+%, TCI America™
Supplier: TCI America T031225G
Specifications
| N-(m-Toluoyl)glycine | |
| 138°C | |
| C10H11NO3 | |
| 25 g | |
| YKAKNMHEIJUKEX-UHFFFAOYSA-N | |
| 2-[(3-methylphenyl)formamido]acetic acid | |
| 99223 | |
| 193.20 | |
| Crystalline Powder |
| 27115-49-7 | |
| White | |
| MFCD00044399 | |
| 3-methylhippuric acid, m-methylhippuric acid, n-m-toluoyl glycine, m-toluric acid, n-3-methylbenzoyl glycine, 3-methylbenzoylglycine, glycine, n-3-methylbenzoyl, meta-methylhippuric acid, hippuric acid, m-methyl, 3-methyl hippuric acid | |
| CC1=CC=CC(=C1)C(=O)NCC(O)=O | |
| 193.20 | |
| CHEBI:68500 | |
| ≥98.0% (T) |
Chemical Identifiers
| 27115-49-7 | |
| 193.20 | |
| YKAKNMHEIJUKEX-UHFFFAOYSA-N | |
| 99223 | |
| 2-[(3-methylphenyl)formamido]acetic acid |
| C10H11NO3 | |
| MFCD00044399 | |
| 3-methylhippuric acid, m-methylhippuric acid, n-m-toluoyl glycine, m-toluric acid, n-3-methylbenzoyl glycine, 3-methylbenzoylglycine, glycine, n-3-methylbenzoyl, meta-methylhippuric acid, hippuric acid, m-methyl, 3-methyl hippuric acid | |
| CHEBI:68500 | |
| CC1=CC=CC(=C1)C(=O)NCC(O)=O |
Safety and Handling
TSCA : No