missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Nalpha-Benzoyl-L-arginine Ethyl Ester Hydrochloride 98.0+%, TCI America™
Supplier: TCI America B08535G
Specifications
| Nalpha-Benzoyl-L-arginine Ethyl Ester Hydrochloride | |
| 130°C | |
| C15H23ClN4O3 | |
| 5 g | |
| HIXDELXKSSLIKB-UHFFFAOYNA-N | |
| ethyl (2S)-2-benzamido-5-(diaminomethylideneamino)pentanoate;hydrochloride | |
| 2723604 | |
| ≥98.0% (T) |
| 2645-08-1 | |
| White-Yellow | |
| MFCD00012579 | |
| bz-arg-oet.hcl, n-alpha-benzoyl-l-arginine ethyl ester hydrochloride, ethyl n-benzoyl-l-argininate hydrochloride, baee, nalpha-benzoyl-l-arginine ethyl ester hydrochloride, l-baee, l-arginine, n2-benzoyl-, ethyl ester, monohydrochloride, n-benzoyl-l-arginine ethyl ester hydrochloride, ethyl n2-benzoyl-l-argininate monohydrochloride, ethyl 2s-5-carbamimidamido-2-phenylformamido pentanoate hydrochloride | |
| CCOC(=O)C(CCCN=C(N)N)NC(=O)C1=CC=CC=C1.Cl | |
| 342.82 | |
| 342.82 | |
| Crystalline Powder |
Chemical Identifiers
| 2645-08-1 | |
| 342.82 | |
| HIXDELXKSSLIKB-UHFFFAOYNA-N | |
| 2723604 | |
| CCOC(=O)C(CCCN=C(N)N)NC(=O)C1=CC=CC=C1.Cl |
| C15H23ClN4O3 | |
| MFCD00012579 | |
| bz-arg-oet.hcl, n-alpha-benzoyl-l-arginine ethyl ester hydrochloride, ethyl n-benzoyl-l-argininate hydrochloride, baee, nalpha-benzoyl-l-arginine ethyl ester hydrochloride, l-baee, l-arginine, n2-benzoyl-, ethyl ester, monohydrochloride, n-benzoyl-l-arginine ethyl ester hydrochloride, ethyl n2-benzoyl-l-argininate monohydrochloride, ethyl 2s-5-carbamimidamido-2-phenylformamido pentanoate hydrochloride | |
| ethyl (2S)-2-benzamido-5-(diaminomethylideneamino)pentanoate;hydrochloride |
Safety and Handling
TSCA : No