Learn More
Neocuproine hemihydrate, 99+%
CAS: 34302-69-7 | C28H26N4O | 434.54 g/mol
Supplier: Thermo Scientific Chemicals 153320250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Neocuproine hemihydrate | |
| 99.0 | |
| 158.0°C to 163.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00149306,MFCD00004973,MFCD00149306,MFCD23140843 | |
| 15, 6534 | |
| Solubility in water: slightly soluble. Other solubilities: 1500g/L methanol (20°C) | |
| O.CC1=CC=C2C=CC3=CC=C(C)N=C3C2=N1.CC1=CC=C2C=CC3=CC=C(C)N=C3C2=N1 | |
| 434.54 | |
| 217.27 | |
| Crystalline Powder |
| 34302-69-7 | |
| 100.0 | |
| White | |
| 99% min. (Total base) | |
| C28H26N4O | |
| 25 g | |
| unii-2sdt9ev86w, 2sdt9ev86w, neocuproine hemihydrate mi, 1,10-phenanthroline, 2,9-dimethyl-, hemihydrate, 1,10-phenanthroline, 2,9-dimethyl-, hydrate 2:1, 2,9-dimethyl-1,10-phenthroline hemihydrate | |
| IEBXFSLFDFHSRD-UHFFFAOYSA-N | |
| 2,9-dimethyl-1,10-phenanthroline;hydrate | |
| 67652146 | |
| 99+% |
Chemical Identifiers
| 34302-69-7 | |
| 434.54 | |
| IEBXFSLFDFHSRD-UHFFFAOYSA-N | |
| 67652146 |
| C28H26N4O | |
| MFCD00149306,MFCD00004973,MFCD00149306,MFCD23140843 | |
| unii-2sdt9ev86w, 2sdt9ev86w, neocuproine hemihydrate mi, 1,10-phenanthroline, 2,9-dimethyl-, hemihydrate, 1,10-phenanthroline, 2,9-dimethyl-, hydrate 2:1, 2,9-dimethyl-1,10-phenthroline hemihydrate | |
| O.CC1=CC=C2C=CC3=CC=C(C)N=C3C2=N1.CC1=CC=C2C=CC3=CC=C(C)N=C3C2=N1 |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF INHALED: Remove victim to fresh air and k
GHS Signal Word: Warning
RUO – Research Use Only