missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
(+)-Nootkatone 97.0+%, TCI America™
Supplier: TCI America N09201G
Specifications
| (+)-Nootkatone | |
| 36°C | |
| C15H22O | |
| 1 g | |
| WTOYNNBCKUYIKC-SLEUVZQESA-N | |
| (4S,4aR,6S)-4,4a-dimethyl-6-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one | |
| 7567181 | |
| ≥97.0% (GC) |
| 4674-50-4 | |
| White-Yellow | |
| MFCD04974578 | |
| unii-zms1vjk5hy, zms1vjk5hy, nootkatone,-, +-nootkatone, crystalline, 2 3h-naphthalenone, 4,4a,5,6,7,8-hexahydro-4,4a-dimethyl-6-1-methylethenyl-, 4s,4ar,6s, unii-3k3okv2a5a component, 4s,6s,4ar-4,4a-dimethyl-6-1-methylvinyl-3,4,5,6,7,8,4a-heptahydronaphthale n-2-one | |
| CC1CC(=O)C=C2C1(CC(CC2)C(=C)C)C | |
| 218.34 | |
| 218.34 | |
| Crystalline Lumps |
Chemical Identifiers
| 4674-50-4 | |
| 218.34 | |
| WTOYNNBCKUYIKC-SLEUVZQESA-N | |
| 7567181 | |
| CC1CC(=O)C=C2C1(CC(CC2)C(=C)C)C |
| C15H22O | |
| MFCD04974578 | |
| unii-zms1vjk5hy, zms1vjk5hy, nootkatone,-, +-nootkatone, crystalline, 2 3h-naphthalenone, 4,4a,5,6,7,8-hexahydro-4,4a-dimethyl-6-1-methylethenyl-, 4s,4ar,6s, unii-3k3okv2a5a component, 4s,6s,4ar-4,4a-dimethyl-6-1-methylvinyl-3,4,5,6,7,8,4a-heptahydronaphthale n-2-one | |
| (4S,4aR,6S)-4,4a-dimethyl-6-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
Safety and Handling
EINECSNumber : (4)-0595
TSCA : Yes
Recommended Storage : Refrigerator