missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
O-(2,3,4,5,6-Pentafluorobenzyl)hydroxylamine Hydrochloride 98.0+%, TCI America™
Supplier: TCI America P08225G
Specifications
| O-(2,3,4,5,6-Pentafluorobenzyl)hydroxylamine Hydrochloride [for Oxime Preparation] | |
| 215°C | |
| C7H5ClF5NO | |
| 5 g | |
| HVMVKNXIMUCYJA-UHFFFAOYSA-N | |
| hydrogen O-[(2,3,4,5,6-pentafluorophenyl)methyl]hydroxylamine chloride | |
| 122307 | |
| ≥98.0% (HPLC,N) |
| 57981-02-9 | |
| White | |
| MFCD00012953 | |
| o-2,3,4,5,6-pentafluorobenzyl hydroxylamine hydrochloride, florox reagent, o-perfluorophenyl methyl hydroxylamine hydrochloride, hydroxylamine, o-pentafluorophenyl methyl-, hydrochloride, o-pentafluorobenzyl hydroxylamine hydrochloride, o-2,3,4,5,6-pentafluorophenyl methyl hydroxylamine hydrochloride, oxy 2,3,4,5,6-pentafluorophenyl methyl amine, chloride, pfbha.hcl, acmc-1b0zv | |
| [H+].[Cl-].NOCC1=C(F)C(F)=C(F)C(F)=C1F | |
| 249.57 | |
| 249.57 | |
| Crystalline Powder |
Chemical Identifiers
| 57981-02-9 | |
| 249.57 | |
| HVMVKNXIMUCYJA-UHFFFAOYSA-N | |
| 122307 | |
| [H+].[Cl-].NOCC1=C(F)C(F)=C(F)C(F)=C1F |
| C7H5ClF5NO | |
| MFCD00012953 | |
| o-2,3,4,5,6-pentafluorobenzyl hydroxylamine hydrochloride, florox reagent, o-perfluorophenyl methyl hydroxylamine hydrochloride, hydroxylamine, o-pentafluorophenyl methyl-, hydrochloride, o-pentafluorobenzyl hydroxylamine hydrochloride, o-2,3,4,5,6-pentafluorophenyl methyl hydroxylamine hydrochloride, oxy 2,3,4,5,6-pentafluorophenyl methyl amine, chloride, pfbha.hcl, acmc-1b0zv | |
| hydrogen O-[(2,3,4,5,6-pentafluorophenyl)methyl]hydroxylamine chloride |
Safety and Handling
TSCA : No